C9H14Cl2N2O — CID 19807713
2-chloro-1-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride (PubChem CID 19807713) has the molecular formula C9H14Cl2N2O and a molecular weight of 237.13 g/mol. Its IUPAC name is 2-chloro-1-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride.
| Compound Name | 2-chloro-1-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 19807713 |
| Molecular Formula | C9H14Cl2N2O |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-chloro-1-N-(2-methoxyethyl)benzene-1,4-diamine;hydrochloride |
| SMILES | COCCNc1ccc(N)cc1Cl.Cl |
| InChI | InChI=1S/C9H13ClN2O.ClH/c1-13-5-4-12-9-3-2-7(11)6-8(9)10;/h2-3,6,12H,4-5,11H2,1H3;1H |
| InChIKey | YHHMDXBUCITINA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|