C10H15ClN2O — CID 43115381
2-chloro-1-N-(1-methoxypropan-2-yl)benzene-1,4-diamine (PubChem CID 43115381) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 2-chloro-1-N-(1-methoxypropan-2-yl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(1-methoxypropan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43115381 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-chloro-1-N-(1-methoxypropan-2-yl)benzene-1,4-diamine |
| SMILES | COCC(C)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C10H15ClN2O/c1-7(6-14-2)13-10-4-3-8(12)5-9(10)11/h3-5,7,13H,6,12H2,1-2H3 |
| InChIKey | JWLRDGCTFTWHBK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|