C12H18Cl2N2O — CID 54806172
N'-(2,4-dichlorophenyl)-N-(3-methoxypropyl)ethane-1,2-diamine (PubChem CID 54806172) has the molecular formula C12H18Cl2N2O and a molecular weight of 277.19 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-N-(3-methoxypropyl)ethane-1,2-diamine.
| Compound Name | N'-(2,4-dichlorophenyl)-N-(3-methoxypropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54806172 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-N-(3-methoxypropyl)ethane-1,2-diamine |
| SMILES | COCCCNCCNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2O/c1-17-8-2-5-15-6-7-16-12-4-3-10(13)9-11(12)14/h3-4,9,15-16H,2,5-8H2,1H3 |
| InChIKey | PQYGJICXHYUIGB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|