C9H11Cl2NO — CID 28568177
2,5-dichloro-N-(2-methoxyethyl)aniline (PubChem CID 28568177) has the molecular formula C9H11Cl2NO and a molecular weight of 220.10 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-methoxyethyl)aniline.
| Compound Name | 2,5-dichloro-N-(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 28568177 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2,5-dichloro-N-(2-methoxyethyl)aniline |
| SMILES | COCCNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H11Cl2NO/c1-13-5-4-12-9-6-7(10)2-3-8(9)11/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | DFEMHGYLXQRURP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|