C13H19Cl2NO3 — CID 104561306
2,5-dichloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]aniline (PubChem CID 104561306) has the molecular formula C13H19Cl2NO3 and a molecular weight of 308.20 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]aniline.
| Compound Name | 2,5-dichloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]aniline |
|---|---|
| PubChem CID | 104561306 |
| Molecular Formula | C13H19Cl2NO3 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2,5-dichloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]aniline |
| SMILES | COCCOCCOCCNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO3/c1-17-6-7-19-9-8-18-5-4-16-13-10-11(14)2-3-12(13)15/h2-3,10,16H,4-9H2,1H3 |
| InChIKey | NRXPSVBYDWGIQF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|