C13H19Cl2NO2 — CID 81093702
2,5-dichloro-N-(3,3-diethoxypropyl)aniline (PubChem CID 81093702) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,3-diethoxypropyl)aniline.
| Compound Name | 2,5-dichloro-N-(3,3-diethoxypropyl)aniline |
|---|---|
| PubChem CID | 81093702 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2,5-dichloro-N-(3,3-diethoxypropyl)aniline |
| SMILES | CCOC(CCNc1cc(Cl)ccc1Cl)OCC |
| InChI | InChI=1S/C13H19Cl2NO2/c1-3-17-13(18-4-2)7-8-16-12-9-10(14)5-6-11(12)15/h5-6,9,13,16H,3-4,7-8H2,1-2H3 |
| InChIKey | CHJJLSHCICHHQE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|