C14H22FNO2 — CID 81095045
N-(3,3-diethoxypropyl)-4-fluoro-2-methylaniline (PubChem CID 81095045) has the molecular formula C14H22FNO2 and a molecular weight of 255.33 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-4-fluoro-2-methylaniline.
| Compound Name | N-(3,3-diethoxypropyl)-4-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 81095045 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-(3,3-diethoxypropyl)-4-fluoro-2-methylaniline |
| SMILES | CCOC(CCNc1ccc(F)cc1C)OCC |
| InChI | InChI=1S/C14H22FNO2/c1-4-17-14(18-5-2)8-9-16-13-7-6-12(15)10-11(13)3/h6-7,10,14,16H,4-5,8-9H2,1-3H3 |
| InChIKey | XQQHDSNRCRLKJG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|