C13H19BrFNO2 — CID 81093558
4-bromo-N-(3,3-diethoxypropyl)-2-fluoroaniline (PubChem CID 81093558) has the molecular formula C13H19BrFNO2 and a molecular weight of 320.20 g/mol. Its IUPAC name is 4-bromo-N-(3,3-diethoxypropyl)-2-fluoroaniline.
| Compound Name | 4-bromo-N-(3,3-diethoxypropyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 81093558 |
| Molecular Formula | C13H19BrFNO2 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-bromo-N-(3,3-diethoxypropyl)-2-fluoroaniline |
| SMILES | CCOC(CCNc1ccc(Br)cc1F)OCC |
| InChI | InChI=1S/C13H19BrFNO2/c1-3-17-13(18-4-2)7-8-16-12-6-5-10(14)9-11(12)15/h5-6,9,13,16H,3-4,7-8H2,1-2H3 |
| InChIKey | SFQARKLBMJNGHI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|