C13H18BrF2NO2 — CID 81093418
2-bromo-N-(3,3-diethoxypropyl)-4,6-difluoroaniline (PubChem CID 81093418) has the molecular formula C13H18BrF2NO2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-bromo-N-(3,3-diethoxypropyl)-4,6-difluoroaniline.
| Compound Name | 2-bromo-N-(3,3-diethoxypropyl)-4,6-difluoroaniline |
|---|---|
| PubChem CID | 81093418 |
| Molecular Formula | C13H18BrF2NO2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-bromo-N-(3,3-diethoxypropyl)-4,6-difluoroaniline |
| SMILES | CCOC(CCNc1c(F)cc(F)cc1Br)OCC |
| InChI | InChI=1S/C13H18BrF2NO2/c1-3-18-12(19-4-2)5-6-17-13-10(14)7-9(15)8-11(13)16/h7-8,12,17H,3-6H2,1-2H3 |
| InChIKey | UACWIWXRVXFYCP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|