C11H14BrF2N — CID 43347538
2-bromo-4,6-difluoro-N-pentylaniline (PubChem CID 43347538) has the molecular formula C11H14BrF2N and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-pentylaniline.
| Compound Name | 2-bromo-4,6-difluoro-N-pentylaniline |
|---|---|
| PubChem CID | 43347538 |
| Molecular Formula | C11H14BrF2N |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-pentylaniline |
| SMILES | CCCCCNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H14BrF2N/c1-2-3-4-5-15-11-9(12)6-8(13)7-10(11)14/h6-7,15H,2-5H2,1H3 |
| InChIKey | RIYMFWYCKWGGEC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|