C11H14Br2FN — CID 69428325
2,6-dibromo-4-fluoro-N-pentylaniline (PubChem CID 69428325) has the molecular formula C11H14Br2FN and a molecular weight of 339.05 g/mol. Its IUPAC name is 2,6-dibromo-4-fluoro-N-pentylaniline.
| Compound Name | 2,6-dibromo-4-fluoro-N-pentylaniline |
|---|---|
| PubChem CID | 69428325 |
| Molecular Formula | C11H14Br2FN |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 2,6-dibromo-4-fluoro-N-pentylaniline |
| SMILES | CCCCCNc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C11H14Br2FN/c1-2-3-4-5-15-11-9(12)6-8(14)7-10(11)13/h6-7,15H,2-5H2,1H3 |
| InChIKey | CGKFANDPEKPAIN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|