C9H10BrF2N — CID 43168257
2-bromo-4,6-difluoro-N-propylaniline (PubChem CID 43168257) has the molecular formula C9H10BrF2N and a molecular weight of 250.09 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-propylaniline.
| Compound Name | 2-bromo-4,6-difluoro-N-propylaniline |
|---|---|
| PubChem CID | 43168257 |
| Molecular Formula | C9H10BrF2N |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-propylaniline |
| SMILES | CCCNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C9H10BrF2N/c1-2-3-13-9-7(10)4-6(11)5-8(9)12/h4-5,13H,2-3H2,1H3 |
| InChIKey | BDWMITJVECZZMN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |