C13H12BrF2NO — CID 62345433
2-bromo-N-[(5-ethylfuran-2-yl)methyl]-4,6-difluoroaniline (PubChem CID 62345433) has the molecular formula C13H12BrF2NO and a molecular weight of 316.15 g/mol. Its IUPAC name is 2-bromo-N-[(5-ethylfuran-2-yl)methyl]-4,6-difluoroaniline.
| Compound Name | 2-bromo-N-[(5-ethylfuran-2-yl)methyl]-4,6-difluoroaniline |
|---|---|
| PubChem CID | 62345433 |
| Molecular Formula | C13H12BrF2NO |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-bromo-N-[(5-ethylfuran-2-yl)methyl]-4,6-difluoroaniline |
| SMILES | CCc1ccc(CNc2c(F)cc(F)cc2Br)o1 |
| InChI | InChI=1S/C13H12BrF2NO/c1-2-9-3-4-10(18-9)7-17-13-11(14)5-8(15)6-12(13)16/h3-6,17H,2,7H2,1H3 |
| InChIKey | LHVFSBRVYFFPPS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |