C13H8BrF4N — CID 43312818
2-bromo-N-[(2,5-difluorophenyl)methyl]-4,6-difluoroaniline (PubChem CID 43312818) has the molecular formula C13H8BrF4N and a molecular weight of 334.11 g/mol. Its IUPAC name is 2-bromo-N-[(2,5-difluorophenyl)methyl]-4,6-difluoroaniline.
| Compound Name | 2-bromo-N-[(2,5-difluorophenyl)methyl]-4,6-difluoroaniline |
|---|---|
| PubChem CID | 43312818 |
| Molecular Formula | C13H8BrF4N |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2-bromo-N-[(2,5-difluorophenyl)methyl]-4,6-difluoroaniline |
| SMILES | Fc1cc(F)c(NCc2cc(F)ccc2F)c(Br)c1 |
| InChI | InChI=1S/C13H8BrF4N/c14-10-4-9(16)5-12(18)13(10)19-6-7-3-8(15)1-2-11(7)17/h1-5,19H,6H2 |
| InChIKey | LWJLPUCRBHUYGG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |