C13H8Br3F2N — CID 28991921
2,4,6-tribromo-N-[(2,4-difluorophenyl)methyl]aniline (PubChem CID 28991921) has the molecular formula C13H8Br3F2N and a molecular weight of 455.92 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(2,4-difluorophenyl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(2,4-difluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 28991921 |
| Molecular Formula | C13H8Br3F2N |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 452.82 |
| IUPAC Name | 2,4,6-tribromo-N-[(2,4-difluorophenyl)methyl]aniline |
| SMILES | Fc1ccc(CNc2c(Br)cc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C13H8Br3F2N/c14-8-3-10(15)13(11(16)4-8)19-6-7-1-2-9(17)5-12(7)18/h1-5,19H,6H2 |
| InChIKey | VDSOOLJQHFHSQT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |