C14H9BrF2N2 — CID 114880935
2-bromo-6-[(2,4-difluorophenyl)methylamino]benzonitrile (PubChem CID 114880935) has the molecular formula C14H9BrF2N2 and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-bromo-6-[(2,4-difluorophenyl)methylamino]benzonitrile.
| Compound Name | 2-bromo-6-[(2,4-difluorophenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 114880935 |
| Molecular Formula | C14H9BrF2N2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-bromo-6-[(2,4-difluorophenyl)methylamino]benzonitrile |
| SMILES | N#Cc1c(Br)cccc1NCc1ccc(F)cc1F |
| InChI | InChI=1S/C14H9BrF2N2/c15-12-2-1-3-14(11(12)7-18)19-8-9-4-5-10(16)6-13(9)17/h1-6,19H,8H2 |
| InChIKey | BWJUAROKSZUKMH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |