C14H8BrF3N2 — CID 102847201
4-[(5-bromo-2,4-difluoroanilino)methyl]-3-fluorobenzonitrile (PubChem CID 102847201) has the molecular formula C14H8BrF3N2 and a molecular weight of 341.13 g/mol. Its IUPAC name is 4-[(5-bromo-2,4-difluoroanilino)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(5-bromo-2,4-difluoroanilino)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 102847201 |
| Molecular Formula | C14H8BrF3N2 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 4-[(5-bromo-2,4-difluoroanilino)methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CNc2cc(Br)c(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C14H8BrF3N2/c15-10-4-14(13(18)5-12(10)17)20-7-9-2-1-8(6-19)3-11(9)16/h1-5,20H,7H2 |
| InChIKey | LMPWMSPXYVBLTL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|