C12H8ClFN4 — CID 133346590
4-[[(6-chloropyrazin-2-yl)amino]methyl]-3-fluorobenzonitrile (PubChem CID 133346590) has the molecular formula C12H8ClFN4 and a molecular weight of 262.68 g/mol. Its IUPAC name is 4-[[(6-chloropyrazin-2-yl)amino]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[(6-chloropyrazin-2-yl)amino]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 133346590 |
| Molecular Formula | C12H8ClFN4 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-[[(6-chloropyrazin-2-yl)amino]methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CNc2cncc(Cl)n2)c(F)c1 |
| InChI | InChI=1S/C12H8ClFN4/c13-11-6-16-7-12(18-11)17-5-9-2-1-8(4-15)3-10(9)14/h1-3,6-7H,5H2,(H,17,18) |
| InChIKey | FEEZROFJZQFSPS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |