C14H10FN5 — CID 107543250
2-[(4-cyano-2-fluorophenyl)methylamino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107543250) has the molecular formula C14H10FN5 and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methylamino]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methylamino]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107543250 |
| Molecular Formula | C14H10FN5 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methylamino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCc2ccc(C#N)cc2F)n1 |
| InChI | InChI=1S/C14H10FN5/c1-9-4-12(7-17)20-14(19-9)18-8-11-3-2-10(6-16)5-13(11)15/h2-5H,8H2,1H3,(H,18,19,20) |
| InChIKey | WQZSBRSVYMVFOS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |