C12H8FN5O2 — CID 63359181
3-fluoro-4-[[(5-nitropyrimidin-2-yl)amino]methyl]benzonitrile (PubChem CID 63359181) has the molecular formula C12H8FN5O2 and a molecular weight of 273.23 g/mol. Its IUPAC name is 3-fluoro-4-[[(5-nitropyrimidin-2-yl)amino]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[(5-nitropyrimidin-2-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 63359181 |
| Molecular Formula | C12H8FN5O2 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-fluoro-4-[[(5-nitropyrimidin-2-yl)amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2ncc([N+](=O)[O-])cn2)c(F)c1 |
| InChI | InChI=1S/C12H8FN5O2/c13-11-3-8(4-14)1-2-9(11)5-15-12-16-6-10(7-17-12)18(19)20/h1-3,6-7H,5H2,(H,15,16,17) |
| InChIKey | JYSZZKVDQSVUOQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|