C15H11Br2FN2 — CID 28991488
4-[(2,6-dibromo-4-methylanilino)methyl]-3-fluorobenzonitrile (PubChem CID 28991488) has the molecular formula C15H11Br2FN2 and a molecular weight of 398.07 g/mol. Its IUPAC name is 4-[(2,6-dibromo-4-methylanilino)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(2,6-dibromo-4-methylanilino)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 28991488 |
| Molecular Formula | C15H11Br2FN2 |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 4-[(2,6-dibromo-4-methylanilino)methyl]-3-fluorobenzonitrile |
| SMILES | Cc1cc(Br)c(NCc2ccc(C#N)cc2F)c(Br)c1 |
| InChI | InChI=1S/C15H11Br2FN2/c1-9-4-12(16)15(13(17)5-9)20-8-11-3-2-10(7-19)6-14(11)18/h2-6,20H,8H2,1H3 |
| InChIKey | GLZWODLNLQPRMW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |