C14H12FN3 — CID 63359185
3-fluoro-4-[[(5-methyl-2-pyridinyl)amino]methyl]benzonitrile (PubChem CID 63359185) has the molecular formula C14H12FN3 and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-fluoro-4-[[(5-methyl-2-pyridinyl)amino]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[(5-methyl-2-pyridinyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 63359185 |
| Molecular Formula | C14H12FN3 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-fluoro-4-[[(5-methyl-2-pyridinyl)amino]methyl]benzonitrile |
| SMILES | Cc1ccc(NCc2ccc(C#N)cc2F)nc1 |
| InChI | InChI=1S/C14H12FN3/c1-10-2-5-14(17-8-10)18-9-12-4-3-11(7-16)6-13(12)15/h2-6,8H,9H2,1H3,(H,17,18) |
| InChIKey | BVTXWXCWGXMHOE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |