C16H11FN4 — CID 63359270
3-fluoro-4-[(phthalazin-1-ylamino)methyl]benzonitrile (PubChem CID 63359270) has the molecular formula C16H11FN4 and a molecular weight of 278.29 g/mol. Its IUPAC name is 3-fluoro-4-[(phthalazin-1-ylamino)methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(phthalazin-1-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 63359270 |
| Molecular Formula | C16H11FN4 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-fluoro-4-[(phthalazin-1-ylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2nncc3ccccc23)c(F)c1 |
| InChI | InChI=1S/C16H11FN4/c17-15-7-11(8-18)5-6-13(15)9-19-16-14-4-2-1-3-12(14)10-20-21-16/h1-7,10H,9H2,(H,19,21) |
| InChIKey | YUMDVIYNIIJVEU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |