C15H10FN3O — CID 63359756
4-[(1,3-benzoxazol-2-ylamino)methyl]-3-fluorobenzonitrile (PubChem CID 63359756) has the molecular formula C15H10FN3O and a molecular weight of 267.26 g/mol. Its IUPAC name is 4-[(1,3-benzoxazol-2-ylamino)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(1,3-benzoxazol-2-ylamino)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 63359756 |
| Molecular Formula | C15H10FN3O |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-[(1,3-benzoxazol-2-ylamino)methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CNc2nc3ccccc3o2)c(F)c1 |
| InChI | InChI=1S/C15H10FN3O/c16-12-7-10(8-17)5-6-11(12)9-18-15-19-13-3-1-2-4-14(13)20-15/h1-7H,9H2,(H,18,19) |
| InChIKey | QSDAOGDAEBQFNQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |