C15H11F2N3 — CID 63793401
N-[(2,5-difluorophenyl)methyl]phthalazin-1-amine (PubChem CID 63793401) has the molecular formula C15H11F2N3 and a molecular weight of 271.27 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]phthalazin-1-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 63793401 |
| Molecular Formula | C15H11F2N3 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]phthalazin-1-amine |
| SMILES | Fc1ccc(F)c(CNc2nncc3ccccc23)c1 |
| InChI | InChI=1S/C15H11F2N3/c16-12-5-6-14(17)11(7-12)8-18-15-13-4-2-1-3-10(13)9-19-20-15/h1-7,9H,8H2,(H,18,20) |
| InChIKey | DOHHEQIBRUFLHR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |