C12H8F4N2 — CID 112675874
N-[(2,5-difluorophenyl)methyl]-3,5-difluoropyridin-2-amine (PubChem CID 112675874) has the molecular formula C12H8F4N2 and a molecular weight of 256.20 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-3,5-difluoropyridin-2-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112675874 |
| Molecular Formula | C12H8F4N2 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-3,5-difluoropyridin-2-amine |
| SMILES | Fc1cnc(NCc2cc(F)ccc2F)c(F)c1 |
| InChI | InChI=1S/C12H8F4N2/c13-8-1-2-10(15)7(3-8)5-17-12-11(16)4-9(14)6-18-12/h1-4,6H,5H2,(H,17,18) |
| InChIKey | UTIJAFGTHLMVMQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |