C12H9ClF2N2 — CID 55235504
5-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-2-amine (PubChem CID 55235504) has the molecular formula C12H9ClF2N2 and a molecular weight of 254.67 g/mol. Its IUPAC name is 5-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-2-amine.
| Compound Name | 5-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55235504 |
| Molecular Formula | C12H9ClF2N2 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-2-amine |
| SMILES | Fc1ccc(F)c(CNc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C12H9ClF2N2/c13-9-1-4-12(17-7-9)16-6-8-5-10(14)2-3-11(8)15/h1-5,7H,6H2,(H,16,17) |
| InChIKey | HSVWPLWXSNCWSN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |