C12H10ClFN2 — CID 61313125
N-[(4-chlorophenyl)methyl]-5-fluoropyridin-2-amine (PubChem CID 61313125) has the molecular formula C12H10ClFN2 and a molecular weight of 236.68 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5-fluoropyridin-2-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-5-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 61313125 |
| Molecular Formula | C12H10ClFN2 |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-fluoropyridin-2-amine |
| SMILES | Fc1ccc(NCc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C12H10ClFN2/c13-10-3-1-9(2-4-10)7-15-12-6-5-11(14)8-16-12/h1-6,8H,7H2,(H,15,16) |
| InChIKey | RGNVVLJNYJYITP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |