C13H12F2N2O — CID 83308187
5-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]pyridin-2-amine (PubChem CID 83308187) has the molecular formula C13H12F2N2O and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 5-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 83308187 |
| Molecular Formula | C13H12F2N2O |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5-fluoro-N-[(3-fluoro-4-methoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1ccc(CNc2ccc(F)cn2)cc1F |
| InChI | InChI=1S/C13H12F2N2O/c1-18-12-4-2-9(6-11(12)15)7-16-13-5-3-10(14)8-17-13/h2-6,8H,7H2,1H3,(H,16,17) |
| InChIKey | ZOKXWWOKKIDGBW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |