C15H15FN2O2 — CID 167923965
1-[6-[(3-fluoro-4-methoxyphenyl)methylamino]-3-pyridinyl]ethanone (PubChem CID 167923965) has the molecular formula C15H15FN2O2 and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-[6-[(3-fluoro-4-methoxyphenyl)methylamino]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-[(3-fluoro-4-methoxyphenyl)methylamino]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 167923965 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[6-[(3-fluoro-4-methoxyphenyl)methylamino]-3-pyridinyl]ethanone |
| SMILES | COc1ccc(CNc2ccc(C(C)=O)cn2)cc1F |
| InChI | InChI=1S/C15H15FN2O2/c1-10(19)12-4-6-15(18-9-12)17-8-11-3-5-14(20-2)13(16)7-11/h3-7,9H,8H2,1-2H3,(H,17,18) |
| InChIKey | YAPCITYZJAMGJM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |