C15H17FN2O3 — CID 109379922
2-[[5-[(3-fluoro-4-methoxyphenyl)methylamino]-2-pyridinyl]oxy]ethanol (PubChem CID 109379922) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-[[5-[(3-fluoro-4-methoxyphenyl)methylamino]-2-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[5-[(3-fluoro-4-methoxyphenyl)methylamino]-2-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 109379922 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[[5-[(3-fluoro-4-methoxyphenyl)methylamino]-2-pyridinyl]oxy]ethanol |
| SMILES | COc1ccc(CNc2ccc(OCCO)nc2)cc1F |
| InChI | InChI=1S/C15H17FN2O3/c1-20-14-4-2-11(8-13(14)16)9-17-12-3-5-15(18-10-12)21-7-6-19/h2-5,8,10,17,19H,6-7,9H2,1H3 |
| InChIKey | KHBLDGHRWAAWND-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |