C13H11ClN2O2 — CID 28740301
6-[(4-chlorophenyl)methylamino]pyridine-3-carboxylic acid (PubChem CID 28740301) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[(4-chlorophenyl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 28740301 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 6-[(4-chlorophenyl)methylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C13H11ClN2O2/c14-11-4-1-9(2-5-11)7-15-12-6-3-10(8-16-12)13(17)18/h1-6,8H,7H2,(H,15,16)(H,17,18) |
| InChIKey | VRBMOSZDOGWDAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |