C12H8BrClF2N2 — CID 114051986
5-bromo-2-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-3-amine (PubChem CID 114051986) has the molecular formula C12H8BrClF2N2 and a molecular weight of 333.56 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-3-amine.
| Compound Name | 5-bromo-2-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 114051986 |
| Molecular Formula | C12H8BrClF2N2 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[(2,5-difluorophenyl)methyl]pyridin-3-amine |
| SMILES | Fc1ccc(F)c(CNc2cc(Br)cnc2Cl)c1 |
| InChI | InChI=1S/C12H8BrClF2N2/c13-8-4-11(12(14)18-6-8)17-5-7-3-9(15)1-2-10(7)16/h1-4,6,17H,5H2 |
| InChIKey | LUQHCGHACKYPHQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|