C13H11BrF2N2 — CID 113379891
6-bromo-N-[(2,5-difluorophenyl)methyl]-5-methylpyridin-3-amine (PubChem CID 113379891) has the molecular formula C13H11BrF2N2 and a molecular weight of 313.15 g/mol. Its IUPAC name is 6-bromo-N-[(2,5-difluorophenyl)methyl]-5-methylpyridin-3-amine.
| Compound Name | 6-bromo-N-[(2,5-difluorophenyl)methyl]-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 113379891 |
| Molecular Formula | C13H11BrF2N2 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 6-bromo-N-[(2,5-difluorophenyl)methyl]-5-methylpyridin-3-amine |
| SMILES | Cc1cc(NCc2cc(F)ccc2F)cnc1Br |
| InChI | InChI=1S/C13H11BrF2N2/c1-8-4-11(7-18-13(8)14)17-6-9-5-10(15)2-3-12(9)16/h2-5,7,17H,6H2,1H3 |
| InChIKey | YPMFJHAILRZJOM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|