C11H9F2N3 — CID 112675579
3,5-difluoro-N-(pyridin-2-ylmethyl)pyridin-2-amine (PubChem CID 112675579) has the molecular formula C11H9F2N3 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3,5-difluoro-N-(pyridin-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3,5-difluoro-N-(pyridin-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 112675579 |
| Molecular Formula | C11H9F2N3 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3,5-difluoro-N-(pyridin-2-ylmethyl)pyridin-2-amine |
| SMILES | Fc1cnc(NCc2ccccn2)c(F)c1 |
| InChI | InChI=1S/C11H9F2N3/c12-8-5-10(13)11(15-6-8)16-7-9-3-1-2-4-14-9/h1-6H,7H2,(H,15,16) |
| InChIKey | OJTRZPGWRMYNGP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |