C10H9FN4 — CID 115749808
5-fluoro-N-(pyridin-2-ylmethyl)pyrimidin-2-amine (PubChem CID 115749808) has the molecular formula C10H9FN4 and a molecular weight of 204.21 g/mol. Its IUPAC name is 5-fluoro-N-(pyridin-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(pyridin-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115749808 |
| Molecular Formula | C10H9FN4 |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-fluoro-N-(pyridin-2-ylmethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCc2ccccn2)nc1 |
| InChI | InChI=1S/C10H9FN4/c11-8-5-13-10(14-6-8)15-7-9-3-1-2-4-12-9/h1-6H,7H2,(H,13,14,15) |
| InChIKey | KRQFGCNAZHXYTH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |