C8H7FN4O — CID 115750236
5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-2-amine (PubChem CID 115750236) has the molecular formula C8H7FN4O and a molecular weight of 194.17 g/mol. Its IUPAC name is 5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115750236 |
| Molecular Formula | C8H7FN4O |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCc2ccon2)nc1 |
| InChI | InChI=1S/C8H7FN4O/c9-6-3-10-8(11-4-6)12-5-7-1-2-14-13-7/h1-4H,5H2,(H,10,11,12) |
| InChIKey | DWNKQGMIZSEEDW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |