About 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine
2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine (PubChem CID 81178030) has the molecular formula C8H6ClFN4O
and a molecular weight of 228.61 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 81178030 |
| Molecular Formula | C8H6ClFN4O |
| Molecular Weight | 228.61 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Fc1cnc(Cl)nc1NCc1ccon1 |
| InChI | InChI=1S/C8H6ClFN4O/c9-8-12-4-6(10)7(13-8)11-3-5-1-2-15-14-5/h1-2,4H,3H2,(H,11,12,13) |
| InChIKey | HJLVPZQJMVMVJE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine (CID 81178030) is 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine is Fc1cnc(Cl)nc1NCc1ccon1.
What is the InChIKey of 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine?
The InChIKey is HJLVPZQJMVMVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFN4O/c9-8-12-4-6(10)7(13-8)11-3-5-1-2-15-14-5/h1-2,4H,3H2,(H,11,12,13).
What are the key properties of 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine?
2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine has a molecular weight of 228.61 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-fluoro-N-(1,2-oxazol-3-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 81178030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).