C10H9ClFN5 — CID 79080911
2-chloro-5-fluoro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine (PubChem CID 79080911) has the molecular formula C10H9ClFN5 and a molecular weight of 253.67 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 79080911 |
| Molecular Formula | C10H9ClFN5 |
| Molecular Weight | 253.67 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-chloro-5-fluoro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1cnc(CNc2nc(Cl)ncc2F)cn1 |
| InChI | InChI=1S/C10H9ClFN5/c1-6-2-14-7(3-13-6)4-15-9-8(12)5-16-10(11)17-9/h2-3,5H,4H2,1H3,(H,15,16,17) |
| InChIKey | HPAMQROSEKWFQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.67 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |