C11H11ClFN3S — CID 106014067
2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-fluoropyrimidin-4-amine (PubChem CID 106014067) has the molecular formula C11H11ClFN3S and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-fluoropyrimidin-4-amine.
| Compound Name | 2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 106014067 |
| Molecular Formula | C11H11ClFN3S |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-fluoropyrimidin-4-amine |
| SMILES | CCc1ccc(CNc2nc(Cl)ncc2F)s1 |
| InChI | InChI=1S/C11H11ClFN3S/c1-2-7-3-4-8(17-7)5-14-10-9(13)6-15-11(12)16-10/h3-4,6H,2,5H2,1H3,(H,14,15,16) |
| InChIKey | QFVGYFRBVTVJMB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |