C11H8ClF2N3 — CID 79081337
2-chloro-5-fluoro-N-[(4-fluorophenyl)methyl]pyrimidin-4-amine (PubChem CID 79081337) has the molecular formula C11H8ClF2N3 and a molecular weight of 255.66 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[(4-fluorophenyl)methyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-[(4-fluorophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 79081337 |
| Molecular Formula | C11H8ClF2N3 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-chloro-5-fluoro-N-[(4-fluorophenyl)methyl]pyrimidin-4-amine |
| SMILES | Fc1ccc(CNc2nc(Cl)ncc2F)cc1 |
| InChI | InChI=1S/C11H8ClF2N3/c12-11-16-6-9(14)10(17-11)15-5-7-1-3-8(13)4-2-7/h1-4,6H,5H2,(H,15,16,17) |
| InChIKey | BEWUGCBTVVAJFI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |