C10H10ClN5 — CID 105369387
5-chloro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine (PubChem CID 105369387) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is 5-chloro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 105369387 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-chloro-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1cnc(CNc2ncncc2Cl)cn1 |
| InChI | InChI=1S/C10H10ClN5/c1-7-2-14-8(3-13-7)4-15-10-9(11)5-12-6-16-10/h2-3,5-6H,4H2,1H3,(H,12,15,16) |
| InChIKey | HPUJHIDRALHALZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |