C17H14N6 — CID 3234751
2-[4-[(5-methylpyrazin-2-yl)methylamino]pyrimidin-5-yl]benzonitrile (PubChem CID 3234751) has the molecular formula C17H14N6 and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-[4-[(5-methylpyrazin-2-yl)methylamino]pyrimidin-5-yl]benzonitrile.
| Compound Name | 2-[4-[(5-methylpyrazin-2-yl)methylamino]pyrimidin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 3234751 |
| Molecular Formula | C17H14N6 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-[4-[(5-methylpyrazin-2-yl)methylamino]pyrimidin-5-yl]benzonitrile |
| SMILES | Cc1cnc(CNc2ncncc2-c2ccccc2C#N)cn1 |
| InChI | InChI=1S/C17H14N6/c1-12-7-21-14(8-20-12)9-22-17-16(10-19-11-23-17)15-5-3-2-4-13(15)6-18/h2-5,7-8,10-11H,9H2,1H3,(H,19,22,23) |
| InChIKey | YIFJQOSOEFTEHM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |