C12H10ClN5 — CID 107057587
3-chloro-2-[(5-methylpyrazin-2-yl)methylamino]pyridine-4-carbonitrile (PubChem CID 107057587) has the molecular formula C12H10ClN5 and a molecular weight of 259.70 g/mol. Its IUPAC name is 3-chloro-2-[(5-methylpyrazin-2-yl)methylamino]pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-[(5-methylpyrazin-2-yl)methylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107057587 |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 3-chloro-2-[(5-methylpyrazin-2-yl)methylamino]pyridine-4-carbonitrile |
| SMILES | Cc1cnc(CNc2nccc(C#N)c2Cl)cn1 |
| InChI | InChI=1S/C12H10ClN5/c1-8-5-17-10(6-16-8)7-18-12-11(13)9(4-14)2-3-15-12/h2-3,5-6H,7H2,1H3,(H,15,18) |
| InChIKey | MIYREANMWUIHOA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |