C9H8ClN3 — CID 107056845
3-chloro-2-(prop-2-enylamino)pyridine-4-carbonitrile (PubChem CID 107056845) has the molecular formula C9H8ClN3 and a molecular weight of 193.64 g/mol. Its IUPAC name is 3-chloro-2-(prop-2-enylamino)pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-(prop-2-enylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107056845 |
| Molecular Formula | C9H8ClN3 |
| Molecular Weight | 193.64 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-chloro-2-(prop-2-enylamino)pyridine-4-carbonitrile |
| SMILES | C=CCNc1nccc(C#N)c1Cl |
| InChI | InChI=1S/C9H8ClN3/c1-2-4-12-9-8(10)7(6-11)3-5-13-9/h2-3,5H,1,4H2,(H,12,13) |
| InChIKey | XFIBQXPZMLGAAG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|