C9H11ClN4O2S — CID 107056968
N-[2-[(3-chloro-4-cyano-2-pyridinyl)amino]ethyl]methanesulfonamide (PubChem CID 107056968) has the molecular formula C9H11ClN4O2S and a molecular weight of 274.73 g/mol. Its IUPAC name is N-[2-[(3-chloro-4-cyano-2-pyridinyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3-chloro-4-cyano-2-pyridinyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 107056968 |
| Molecular Formula | C9H11ClN4O2S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | N-[2-[(3-chloro-4-cyano-2-pyridinyl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nccc(C#N)c1Cl |
| InChI | InChI=1S/C9H11ClN4O2S/c1-17(15,16)14-5-4-13-9-8(10)7(6-11)2-3-12-9/h2-3,14H,4-5H2,1H3,(H,12,13) |
| InChIKey | TWVCRTXPVSIIMK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|