C10H13ClN4 — CID 107061368
2-[(2-amino-2-methylpropyl)amino]-3-chloropyridine-4-carbonitrile (PubChem CID 107061368) has the molecular formula C10H13ClN4 and a molecular weight of 224.70 g/mol. Its IUPAC name is 2-[(2-amino-2-methylpropyl)amino]-3-chloropyridine-4-carbonitrile.
| Compound Name | 2-[(2-amino-2-methylpropyl)amino]-3-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107061368 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.70 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-[(2-amino-2-methylpropyl)amino]-3-chloropyridine-4-carbonitrile |
| SMILES | CC(C)(N)CNc1nccc(C#N)c1Cl |
| InChI | InChI=1S/C10H13ClN4/c1-10(2,13)6-15-9-8(11)7(5-12)3-4-14-9/h3-4H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | NZRULVMDCUXQHL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.70 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |