C9H10ClN3 — CID 107056636
3-chloro-2-(propan-2-ylamino)pyridine-4-carbonitrile (PubChem CID 107056636) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 3-chloro-2-(propan-2-ylamino)pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-(propan-2-ylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107056636 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-chloro-2-(propan-2-ylamino)pyridine-4-carbonitrile |
| SMILES | CC(C)Nc1nccc(C#N)c1Cl |
| InChI | InChI=1S/C9H10ClN3/c1-6(2)13-9-8(10)7(5-11)3-4-12-9/h3-4,6H,1-2H3,(H,12,13) |
| InChIKey | PXSXDJYQWBNZHE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |