C11H13ClN4O — CID 107057196
2-[(3-chloro-4-cyano-2-pyridinyl)amino]-N-ethylpropanamide (PubChem CID 107057196) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-[(3-chloro-4-cyano-2-pyridinyl)amino]-N-ethylpropanamide.
| Compound Name | 2-[(3-chloro-4-cyano-2-pyridinyl)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 107057196 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[(3-chloro-4-cyano-2-pyridinyl)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Nc1nccc(C#N)c1Cl |
| InChI | InChI=1S/C11H13ClN4O/c1-3-14-11(17)7(2)16-10-9(12)8(6-13)4-5-15-10/h4-5,7H,3H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | GOPWROVXDZDAMZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |