C14H19ClN4 — CID 107061374
2-[(2-amino-1-cyclohexylethyl)amino]-3-chloropyridine-4-carbonitrile (PubChem CID 107061374) has the molecular formula C14H19ClN4 and a molecular weight of 278.79 g/mol. Its IUPAC name is 2-[(2-amino-1-cyclohexylethyl)amino]-3-chloropyridine-4-carbonitrile.
| Compound Name | 2-[(2-amino-1-cyclohexylethyl)amino]-3-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107061374 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[(2-amino-1-cyclohexylethyl)amino]-3-chloropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC(CN)C2CCCCC2)c1Cl |
| InChI | InChI=1S/C14H19ClN4/c15-13-11(8-16)6-7-18-14(13)19-12(9-17)10-4-2-1-3-5-10/h6-7,10,12H,1-5,9,17H2,(H,18,19) |
| InChIKey | ISXXELSJTPXEDN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |